Products
What will AGI do for Acecainide hydrochloride?
This classification denotes a cation channel blocker and antiarrhythmic agent with the molecular formula C15H23N3O2.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier B9K738KX14, chemically known as benzamide, 4-(acetylamino)-n-(2-(diethylamino)ethyl)-, monohydrochloride but more generally known as acecainide hydrochloride, which bears US NIH Compound Identifier 71417. The base compound, acecainide, also comes in base form. Most nations, for tariff and trade purposes, schedule acecainide hydrochloride under HS 29242995 and SITC 51479. As of Q4 2014, ACECAINIDE HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Acecainide hydrochloride bears US NLM identifiers UMLS ID C0282038 and NCI Concept Code C75126. SMILES: CCN(CC)CCNC(=O)C1CCC(CC1)NC(=O)C.CL.