Products
What will AGI do for Acetaminophen glucuronide?
This classification denotes an analgesic and antipyretic with the molecular formula C14H17NO8, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 8BE7G9R76X, chemically known as .beta.-d-glucopyranosiduronic acid, 4-(acetylamino)phenyl, but more generally known as acetaminophen glucuronide, which bears US NIH Compound Identifier 83944. European Medicines Agency schedules acetaminophen glucuronide or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB09611MIG. Most nations, for tariff purposes, schedule acetaminophen glucuronide under HS 29242990. SMILES: CC(=O)NC1CCC(CC1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O.