Products

What will AGI do for Acolbifene?

This classification denotes a selective estrogen receptor modulator with the molecular formula C29H31NO4, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 815LJ9X0D1, chemically known as 2h-1-benzopyran-7-ol, 3-(4-hydroxyphenyl)-4-methyl-2-(4-(2-(1-piperidinyl)ethoxy)phenyl)-, (2s) but generally known as acolbifene, which bears US NIH Compound Identifier 155435. Acolbifene most often comes in base and hydrochloride forms. Acolbifene also comes in hydrochloride form. The term ACOLBIFENE is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 16, No. 3, 2002, List 48). Most nations schedule acolbifene under HS 29349990 and SITC 51579. As of Q4 2014, ACOLBIFENE remains the US FDA Preferred Term for this commodity. Acolbifene bears US NLM identifiers UMLS ID C1122255 and NCI Concept Code C64183. SMILES: CC1=C([C@@H](OC2=C1C=CC(=C2)O)C3=CC=C(C=C3)OCCN4CCCCC4)C5=CC=C(C=C5)O.