Products

What will AGI do for Acriflavine or acriflavinium?

This classification denotes a dye with the molecular formula C13H11N3, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 1T3A50395T, chemically known as acridine-3,6-diamine, but generally known as acriflavine, and which bears US NIH Compound Identifier 443101. European Medicines Agency schedules acriflavine in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB00292MIG. The term ACRIFLAVINE is an International Non-Proprietary Name or INN. Acriflavine or acriflavinium bears US NLM identifiers UMLS ID C0001187 and NCI Concept Code C76253. SMILES: C[N+]1=C2C=C(C=CC2=CC3=C1C=C(C=C3)N)N.C1=CC(=CC2=NC3=C(C=CC(=C3)N)C=C21)N.