Products

What will AGI do for Adefovir pivoxil?

This classification denotes a reverse transcriptase inhibitor with the molecular formula C20H32N5O8P, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier U6Q8Z01514, chemically known as adefovir di(pivaloyloxymethyl) ester [mi], but more generally known as adefovir pivoxil, which bears US NIH Compound Identifier 60871. European Medicines Agency schedules adefovir pivoxil or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB05264MIG. Most nations, for tariff purposes, schedule adefovir pivoxil under HS 29335995. SMILES: CC(C)(C)C(=O)OCOP(=O)(COCCN1CNC2C1NCNC2N)OCOC(=O)C(C)(C)C.