Products

What will AGI do for Adenosine diphosphate?

This classification denotes a nucleoside C10H15N5O10P2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 61D2G4IYVH, chemically known as adenosine, 5'-(trihydrogen pyrophosphate), but more generally known as adenosine diphosphate, which bears US NIH Compound Identifier 6022. European Medicines Agency schedules Adenosine diphosphate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB12740MIG. Most nations, for tariff and trade purposes, schedule adenosine diphosphate under HS 29349990 and SITC 51579. As of Q4 2014, ADENOSINE DIPHOSPHATE remains US FDA's Preferred Term for this commodity. SMILES: C1NC(C2C(N1)N(CN2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)(O)O)O)O)N.