Products

What will AGI do for Adiphenine methyl bromide?

This classification denotes an antispasmotic agent with the molecular formula C21H28NO2.Br, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 2OVU84VI37, chemically known as acetic acid, diphenyl-, ester with diethyl(2-hydroxyethyl)methylammonium bromide, but more generally known as adiphenine methyl bromide, which bears US NIH Compound Identifier 197841. European Medicines Agency schedules adiphenine methyl bromide or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB05272MIG. Most nations, for tariff purposes, schedule adiphenine methyl bromide under HS 29221980. SMILES: CC[N+](C)(CC)CCOC(=O)C(C1CCCCC1)C2CCCCC2.[BR-].