Products
What will AGI do for Albaconazole?
This classification denotes an antifungal agent with the molecular formula C20H16ClF2N5O2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier YDW24Y8IAB, chemically known as 7-chloro-3-((1r,2r)-2-(2,4-difluorophenyl)-2-hydroxy-1-methyl-3-(1h-1,2,4-triazol-1-yl)propyl)quinazolin-4(3h)-one but generally known as albaconazole, which bears US NIH Compound Identifier 208952. European Medicines Agency schedules Albaconazole in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB32139. The term ALBACONAZOLE is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 17, No. 2, 2003, List 49). Most nations schedule albaconazole under HS 29335995 and SITC 51576. As of Q4 2014, ALBACONAZOLE remains the US FDA Preferred Term for this commodity. Albaconazole bears US NLM identifiers UMLS ID C0675272 and NCI Concept Code C72952. SMILES: CLC1CC2NCN(C(C(O)(CN3NCNC3)C3C(F)CC(F)CC3)C)C(=O)C2CC1.