Products

What will AGI do for Algestone acetonide?

This classification denotes a therapeutic progestin with the molecular formula C24H34O4, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier WXD8I4Y1IH, chemically known as 16,17-((1-methylethylidene)bis(oxy))(16 deltaalpha)-pregn-4-ene-3,20-dione but more generally known as algestone acetonide, which bears US NIH Compound Identifier 21075. Most nations, for tariff and trade purposes, schedule algestone acetonide under HS 29372900. As of Q4 2014, ALGESTONE ACETONIDE remains US FDA's Preferred Term for this commodity. Algestone acetonide bears US NLM identifiers UMLS ID C2983959 and NCI Concept Code C90967. SMILES: CC(=O)[C@@]12[C@@H](C[C@@H]3[C@@]1(CC[C@H]4[C@H]3CCC5=CC(=O)CC[C@]45C)C)OC(O2)(C)C.