Products

What will AGI do for Algestone acetophenide?

This classification denotes a therapeutic progestin with the molecular formula C29H36O4, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier OL7KC2O3OT, chemically known as 16alpha,17-((r)-1-phenylethylidendioxy-4-pregnen-3,20-dion but more generally known as algestone acetophenide, which bears US NIH Compound Identifier 32327. European Medicines Agency schedules Algestone acetophenide in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB12773MIG. Most nations, for tariff and trade purposes, schedule algestone acetophenide under HS 29372900. As of Q4 2014, ALGESTONE ACETOPHENIDE remains US FDA's Preferred Term for this commodity. Algestone acetophenide bears US NLM identifiers UMLS ID C0002039 and NCI Concept Code C90968. SMILES: CC(=O)[C@@]12[C@@H](C[C@@H]3[C@@]1(CC[C@H]4[C@H]3CCC5=CC(=O)CC[C@]45C)C)O[C@@](O2)(C)C6CCCCC6.