Products

What will AGI do for Allopurinol sodium?

This classification denotes a xanthine oxidase inhibitor and uricosuric agen with the molecular formula C5H3N4O.Na, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 428673RC2Z, chemically known as 1,5-dihydro-4h-pyrazolo(3,4-d)pyrimidine-4-one but more generally known as allopurinol sodium, which bears US NIH Compound Identifier 2094. The base compound, Allopurinol, comes in other forms, including di-methyl, ribonucleoside, riboside, riboside, and 5-monophosphate. European Medicines Agency schedules Allopurinol sodium in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB30291. Most nations, for tariff and trade purposes, schedule allopurinol sodium under HS 29335995 and SITC 51576. As of Q4 2014, ALLOPURINOL SODIUM remains US FDA's Preferred Term for this commodity. Allopurinol sodium bears US NLM identifiers UMLS ID C0278766 and NCI Concept Code C2564. SMILES: C1C2C(=O)[NH]CNC2[N-]N1.[NA+].