Products

What will AGI do for Althiazide or altizide?

This classification denotes a thiazide diuretic with the molecular formula C11H14ClN3O4S3, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier GI8CB72B0D, chemically known as 6-chloro-3,4-dihydro-3-((2-propenylthio)methyl)-2h-1,2,4-benzothiadiazine-7-sulfonamide but generally known as althiazide, which bears US NIH Compound Identifier 2122. European Medicines Agency schedules Althiazide in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB05379MIG. Althiazide or altizide bears US NLM identifiers UMLS ID C0051500 and NCI Concept Code C80838. SMILES: C=CCSCC1NC2=CC(=C(C=C2S(=O)(=O)N1)S(=O)(=O)N)CL.