Products

What will AGI do for Altinicline?

This classification denotes a cholinergic agonist with the molecular formula C12H14N2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier RJ9V9V09VM, chemically known as pyridine, 3-ethynyl-5-((2s)-1-methyl-2-pyrrolidinyl)- but generally known as altinicline, which bears US NIH Compound Identifier 3036156. Altinicline most often comes in base and maleate forms. The term ALTINICLINE is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 14, No. 3, 2000, List 44). Most nations schedule altinicline under HS 29339990 and SITC 51577. As of Q4 2014, ALTINICLINE remains the US FDA Preferred Term for this commodity. Altinicline bears US NLM identifiers UMLS ID C2698073 and NCI Concept Code C77841. SMILES: CN1CCCC1C2=CN=CC(=C2)C#C.