Products

What will AGI do for Altinicline maleate?

This classification denotes a nicotinic agonist with the molecular formula C12H14N2.C4H4O4, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier PCL7Q9Q62Q, chemically known as pyridine, 3-ethynyl-5-((2s)-1-methyl-2-pyrrolidinyl)-, (2z)-2-butenedioate(1:1) but more generally known as altinicline maleate, which bears US NIH Compound Identifier 6442277. Most nations, for tariff and trade purposes, schedule altinicline maleate under HS 29339990 and SITC 51577. As of Q4 2014, ALTINICLINE MALEATE remains US FDA's Preferred Term for this commodity. Altinicline maleate bears US NLM identifiers UMLS ID C2983930 and NCI Concept Code C90896. SMILES: CN1CCC[C@H]1C2CC(CNC2)C#C.C(=C\C(=O)O)\C(=O)O.