Products

What will AGI do for Alverine citrate?

This classification denotes an antispasmotic agent and anticholinergic agent with the molecular formula C20H27N.C6H8O7, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 9JFB58YK1E, chemically known as n,n-bis(3-phenylpropyl)ethylamine but more generally known as alverine citrate, which bears US NIH Compound Identifier 3678. European Medicines Agency schedules Alverine citrate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB00421MIG. Most nations, for tariff and trade purposes, schedule alverine citrate under HS 29214980 and SITC 51454. As of Q4 2014, ALVERINE CITRATE remains US FDA's Preferred Term for this commodity. Alverine citrate bears US NLM NCI C72692. SMILES: CCN(CCCC1CCCCC1)CCCC2CCCCC2.C(C(=O)O)C(CC(=O)O)(C(=O)O)O.