Products

What will AGI do for Ambutonium?

This classification denotes an antimuscarinic agent with the molecular formula C20H27N2O, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 4O677EQ77U, chemically known as 4-dimethylamino-2,2-diphenylbutyramide but generally known as ambutonium, which bears US NIH Compound Identifier 8276. European Medicines Agency schedules Ambutonium in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB12844MIG. As of Q4 2014, AMBUTONIUM remains the US FDA Preferred Term for this commodity. Ambutonium bears US NLM identifiers UMLS ID C0301368 and NCI Concept Code C79895. SMILES: CC[N+](C)(C)CCC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)N.