Products

What will AGI do for Amdoxovir?

This classification denotes a reverse transcriptase inhibitor with the molecular formula C9H12N6O3, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 54I81H0M9C, chemically known as 2,6-diaminopurine dioxolane but generally known as amdoxovir, which bears US NIH Compound Identifier 124088. European Medicines Agency schedules Amdoxovir in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB20547. The term AMDOXOVIR is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 16., No. 1.2002, List 47). Most nations schedule amdoxovir under HS 29349990 and SITC 51579. As of Q4 2014, AMDOXOVIR remains the US FDA Preferred Term for this commodity. Amdoxovir bears US NLM identifiers UMLS ID C1528970 and NCI Concept Code C76927. SMILES: O1C(n2c3nc(nc(N)c3nc2)N)COC1CO.