Products

What will AGI do for Amidotrizoic acid or diatrizoate or diatrizoic acid?

This classification denotes a contrast agent that practitioners often use (along with this commodity's ester) in x-ray and/or computed tomography (ct) liver studies, an agent with the molecular formula C11H9I3N2O4, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 5UVC90J1LK, chemically known as 2,4,6-triiodo-3,5-diacetamidobenzoic acid but more generally known as diatrizoate, which bears U.S. National Institutes of Health Compound Identifier 2140. Most nations schedule Amidotrizoic acid or diatrizoate or diatrizoic acid under HS 29242995. SMILES: CC(=O)NC1C(C(C(C(C1I)NC(=O)C)I)C(=O)[O-])I.[NA+].