Products

What will AGI do for Amineptine hydrochloride?

This classification denotes an antidepressant agent with the molecular formula C22H27NO2.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier A5P604A12R, chemically known as 7-((10,11-dihydro-5h-dibenzo(a,d)cyclohepten-5-yl)amino)heptanoic acid hydrochloride but more generally known as amineptine hydrochloride, which bears US NIH Compound Identifier 34869. European Medicines Agency schedules Amineptine hydrochloride in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB00447MIG. Most nations, for tariff and trade purposes, schedule amineptine hydrochloride under HS 29224995 and SITC 51465. As of Q4 2014, AMINEPTINE HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. SMILES: C1CCC2C(C1)CCC3CCCCC3C2NCCCCCCC(=O)O.CL.