Products

What will AGI do for Amithiozone or thiacetazone?

This classification denotes an antitubercular agent with the molecular formula C10H12N4OS, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier MMG78X7SSR, chemically known as acetanilide, 4-formyl-, thiosemicarbazone but generally known as amithiozone, which bears US NIH Compound Identifier 2733749. Amithiozone most often comes in base and thiacetazone forms. The term AMITHIOZONE is an International Non-Proprietary Name. Amithiozone or thiacetazone bears US NLM identifiers UMLS ID C0878231 and NCI Concept Code C90769. SMILES: CC(=O)NC1=CC=C(C=C1)C=NNC(=S)N.