Products

What will AGI do for Amopyroquine?

This classification denotes an antimalarial agent with the molecular formula C20H20ClN3O, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier SV6L22Y9QF, chemically known as 4-((7-chloro-4-quinolyl)amino)-alpha-1-pyrrolidinyl-o-cresol or 4-[(7-chloranylquinolin-4-yl)amino]-2-(pyrrolidin-1-ylmethyl)phenol, but generally known as amopyroquine, which bears US NIH Compound Identifier 25194. European Medicines Agency schedules amopyroquine in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB05475MIG. Most nations schedule amopyroquine under HS 29334990 and SITC 51575. As of Q4 2014, AMOPYROQUINE remains the US FDA Preferred Term for this commodity. Amopyroquine bears US NLM identifiers UMLS ID C0051735 and NCI Concept Code C73000. SMILES: C1CCN(C1)CC2=C(C=CC(=C2)NC3=C4C=CC(=CC4=NC=C3)Cl)O.