Products

What will AGI do for Ampicillin sodium?

This classification denotes a penicillin antibiotic with the molecular formula C16H18N3O4S.Na, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier JFN36L5S8K, chemically known as 4-thia-1-azabicyclo(3.2.0)heptane-2-carboxylic acid, 6-((aminophenylacetyl)amino)-3,3-dimethyl-7-oxo-, monosodium salt, (2s-(2alpha,5alpha,6beta(s*)))- but more generally known as ampicillin sodium, which bears US NIH Compound Identifier 6248. The base compound also comes in various forms, including a, acid, anhydrate, anhydrous, base, benzathine, hydrate, natrium, n,n-dibenzylethylenediamine salt, pivaloyloxymethyl ester, pivaloyloxymethyl ester hydrochloride, potassium, and trihydrate and is often combined with cloxacillin and dicloxacillin sodium. European Medicines Agency schedules Ampicillin sodium in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB00508MIG. Most nations, for tariff and trade purposes, schedule ampicillin sodium under HS 29411020 and SITC 54131. As of Q4 2014, AMPICILLIN SODIUM remains US FDA's Preferred Term for this commodity. Ampicillin sodium bears US NLM identifiers UMLS ID C0282052 and NCI Concept Code C47959. SMILES: CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3CCCCC3)N)C(=O)[O-])C.[NA+].