Products

What will AGI do for Amylocaine?

This classification denotes an anesthetic agent with the molecular formula C14H21NO2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier QRW683O56T, chemically known as 2-butanol, 1-(dimethylamino)-2-methyl-, benzoate (ester) but generally known as amylocaine, which bears US NIH Compound Identifier 10767. Amylocaine most often comes in base and hydrochloride forms. European Medicines Agency schedules Amylocaine in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB12893MIG. As of Q4 2014, AMYLOCAINE remains the US FDA Preferred Term for this commodity. Amylocaine bears US NLM identifiers UMLS ID C0081580 and NCI Concept Code C72170. SMILES: O(C(CN(C)C)(CC)C)C(=O)C1CCCCC1.