Products

What will AGI do for Anagrelide hydrochloride?

This classification denotes an antiplatelet agent with the molecular formula C10H7Cl2N3O.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier VNS4435G39, chemically known as 6,7-dichloro-1,5-dihydroimidazo(2,1-b)-quinazolin-2(3h)-one monohydrochloride but generally known as anagrelide hydrochloride, which bears US NIH Compound Identifier 42786. European Medicines Agency schedules Anagrelide hydrochloride in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB00523MIG. Most nations schedule anagrelide hydrochloride under HS 29335995 and SITC 51576. As of Q4 2014, ANAGRELIDE HYDROCHLORIDE remains the US FDA Preferred Term for this commodity. Anagrelide hydrochloride bears US NLM identifiers UMLS ID C0771907 and NCI Concept Code C28826. SMILES: C1C2=C(C=CC(=C2CL)CL)NC3=NC(=O)CN31.CL.