Products

What will AGI do for Apomorphine hydrochloride anhydrous?

This classification denotes a dopamine agonist and antiparkinsonian agent C17H17NO2.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 9K13MD7A0D, chemically known as (6ar)-5,6,6a,7-tetrahydro-6-methyl-4h-dibenzo(de,g)quinoline-10,11-diol hydrochloride, but more generally known as apomorphine hydrochloride anhydrous, which bears US NIH Compound Identifier 9410. Most nations, for tariff and trade purposes, schedule apomorphine hydrochloride anhydrous under HS 29391900 and SITC 54141. As of Q4 2014, APOMORPHINE HYDROCHLORIDE ANHYDROUS remains US FDA's Preferred Term for this commodity. Apomorphine hydrochloride anhydrous bears US NLM identifiers UMLS ID C0887720 and NCI Concept Code C80572. SMILES: CN1CCC2CCCC-3C2[C@H]1CC4C3C(C(CC4)O)O.CL.