Products

What will AGI do for Apraclonidine hydrochloride?

This classification denotes an alpha-adrenergic agonist with the molecular formula C9H10Cl2N4.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier D2VW67N38H, chemically known as 2,6-dichloro-n-(4,5-dihydro-1h-imidazol-2-yl)benzene-1,4-diamine but more generally known as apraclonidine hydrochloride, which bears US NIH Compound Identifier 2216. European Medicines Agency schedules Apraclonidine hydrochloride in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB12926MIG. Most nations, for tariff and trade purposes, schedule apraclonidine hydrochloride under HS 29332990. As of Q4 2014, APRACLONIDINE HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Apraclonidine hydrochloride bears US NLM identifiers UMLS ID C0304657 and NCI Concept Code C47401. SMILES: C1C(CC(C(C1CL)NC2=NCCN2)CL)N.CL.