Products

What will AGI do for Aprobarbital sodium?

This classification denotes a barbiturate C10H13N2O3.Na, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 6T90V76R18, chemically known as 2,4,6(1h,3h,5h)-pyrimidinetrione, 5-(1-methylethyl)-5-(2- propenyl)-, monosodium salt, but more generally known as aprobarbital sodium, which bears US NIH Compound Identifier 23662380. Most nations, for tariff and trade purposes, schedule aprobarbital sodium under HS 29335400 and SITC kg. As of Q4 2014, APROBARBITAL SODIUM remains US FDA's Preferred Term for this commodity. SMILES: CC(C)C1(C(=O)NC(=O)[N-]C1=O)CC=C.[NA+].