Products

What will AGI do for Arofylline?

This classification denotes a phosphodiesterase inhibitor with the molecular formula C14H13ClN4O2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 87L38AY71R, chemically known as 3-(4-chlorophenyl)-1-propyl-3,7-dihydro-1h-purine-2,6-dione but generally known as arofylline, which bears US NIH Compound Identifier 166553. European Medicines Agency schedules Arofylline in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB05566MIG. The term AROFYLLINE is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 11, No. 11997, List 37). Most nations schedule arofylline under HS 29395900 and SITC 54145. As of Q4 2014, AROFYLLINE remains the US FDA Preferred Term for this commodity. Arofylline bears US NLM identifiers UMLS ID C2698184 and NCI Concept Code C74223. SMILES: CLC1CCC(N2C3NC[NH]C3C(=O)N(CCC)C2=O)CC1.