Products

What will AGI do for Atipamezole?

This classification denotes an alpha-adrenergic blocking agent with the molecular formula C14H16N2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 03N9U5JAF6, chemically known as 1h-imidazole, 4-(2-ethyl-2,3-dihydro-1h-inden-2-yl)- but generally known as atipamezole, which bears US NIH Compound Identifier 71310. European Medicines Agency schedules Atipamezole in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB05594MIG. The term ATIPAMEZOLE is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 2, No. 3, 1988, List 28). Most nations schedule atipamezole under HS 29332990 and SITC 51573. As of Q4 2014, ATIPAMEZOLE remains the US FDA Preferred Term for this commodity. Atipamezole bears US NLM identifiers UMLS ID C0052593 and NCI Concept Code C72921. SMILES: [NH]1C(C2(CC3C(C2)CCCC3)CC)CNC1.