Products

What will AGI do for Atomoxetine?

This classification denotes an antidepressant agent with the molecular formula C17H21NO, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier ASW034S0B8, chemically known as benzenepropanamine, n-methyl-gamma-(2-methylphenoxy)-, (gammar)- but generally known as atomoxetine, which bears US NIH Compound Identifier 54841. Atomoxetine most often comes in base and hydrochloride forms. The term ATOMOXETINE is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 16, No. 3, 2002, List 48). World Health Organization schedules atomoxetine in its Anatomical Therapeutic Chemical (ATC) Classification. As of Q4 2014, ATOMOXETINE remains the US FDA Preferred Term for this commodity. Atomoxetine bears US NLM identifiers UMLS ID C0076823 and NCI Concept Code C74141. SMILES: CC1=CC=CC=C1OC(CCNC)C2=CC=CC=C2.