Products

What will AGI do for Atorvastatin lactone?

This classification denotes a hmg-coa reductase inhibitor with the molecular formula C33H33FN2O4, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 7876IL7J2N, chemically known as (+)-atorvastatin lactone, but more generally known as atorvastatin lactone, which bears US NIH Compound Identifier 6483036. European Medicines Agency schedules atorvastatin lactone or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB05600MIG. Most nations, for tariff purposes, schedule atorvastatin lactone under HS 29339990. SMILES: CC(C)C1C(C(C(N1CC[C@@H]2C[C@H](CC(=O)O2)O)C3CCC(CC3)F)C4CCCCC4)C(=O)NC5CCCCC5.