Products

What will AGI do for Azacyclonol hydrochloride?

This classification denotes an anxiolytic with the molecular formula C18H21NO.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 4BXX0XNP9R, chemically known as 4-piperidinemethanol, alpha,alpha-diphenyl-, hydrochloride but more generally known as azacyclonol hydrochloride, which bears US NIH Compound Identifier 15722. European Medicines Agency schedules Azacyclonol hydrochloride in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB00635MIG. Most nations, for tariff and trade purposes, schedule azacyclonol hydrochloride under HS 29333999 and SITC 51574. As of Q4 2014, AZACYCLONOL HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Azacyclonol hydrochloride bears US NLM identifiers UMLS ID C0959907 and NCI Concept Code C76503. SMILES: C1CCC(CC1)C(C2CCCCC2)(C3CCNCC3)O.CL.