Products
What will AGI do for Azamethonium?
This classification denotes an antihypertensive agent with the molecular formula C13H33N3, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 43XK6AW58D, chemically known as ((methylimino)diethylene)bis(ethyldimethylammonium) but generally known as azamethonium, which bears US NIH Compound Identifier 9383. European Medicines Agency schedules Azamethonium in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB21910. The term AZAMETHONIUM is an International Non-Proprietary Name. As of Q4 2014, AZAMETHONIUM remains the US FDA Preferred Term for this commodity. Azamethonium bears US NLM identifiers UMLS ID C2346893 and NCI Concept Code C73610. SMILES: CC[N+](C)(C)CCN(C)CC[N+](C)(C)CC.