Products

What will AGI do for Azapetine?

This classification denotes an alpha-adrenergic blocking agent with the molecular formula C17H17N, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 9TTR0UA2KC, chemically known as 6-allyl-6,7-dihydro-5h-dibenz(c,e)azepine but generally known as azapetine, which bears US NIH Compound Identifier 8966. azapetine most often comes in base, hydrochloride, and phosphate forms. European Medicines Agency schedules Azapetine in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB12970MIG. World Health Organization schedules azapetine in its Anatomical Therapeutic Chemical (ATC) Classification. As of Q4 2014, AZAPETINE remains the US FDA Preferred Term for this commodity. Azapetine bears US NLM identifiers UMLS ID C0052752 and NCI Concept Code C83540. SMILES: N1(CC2C(C3C(C1)CCCC3)CCCC2)CC=C.