Products

What will AGI do for Azidocillin potassium?

This classification denotes a penicillin antibiotic C16H16N5O4S.K, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 7932098147, chemically known as 4-thia-1-azabicyclo(3.2.0)heptane-2-carboxylic acid, 6-((azidophenylacetyl)amino)-3,3-dimethyl-7-oxo-, monopotassium salt, (2s-(2.alpha.,5.alpha.,6.beta.(s*)))-, but more generally known as azidocillin potassium, which bears US NIH Compound Identifier 71587048. European Medicines Agency schedules Azidocillin potassium in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB00643MIG. Most nations, for tariff and trade purposes, schedule azidocillin potassium under HS 29411090 and SITC 54131. As of Q4 2014, AZIDOCILLIN POTASSIUM remains US FDA's Preferred Term for this commodity. Azidocillin potassium bears US NLM identifiers UMLS ID C2986960 and NCI Concept Code C95169. SMILES: CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3CCCCC3)N=[N+]=[N-])C(=O)[O-])C.[K+].