Products

What will AGI do for Azotomycin?

This classification denotes an antineoplastic antibiotic with the molecular formula C17H23N7O8, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 6TQY580E8M, chemically known as l-norleucine, 6-diazo-n-(6-diazo-n-l-gamma-glutamyl-5-oxo-l-norleucyl)-5-oxo- but generally known as azotomycin, which bears US NIH Compound Identifier 24281. Azotomycin most often comes in base and sodium forms. The term AZOTOMYCIN is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 19 1975, List 5). AZOTOMYCIN is scheduled in the U.S. International Trade Commission's Harmonized Tariff System (HTS) Pharmaceutical Appendix. Most nations schedule azotomycin under HS 29419000 and SITC 54139. As of Q4 2014, AZOTOMYCIN remains the US FDA Preferred Term for this commodity. Azotomycin bears US NLM identifiers UMLS ID C0052821 and NCI Concept Code C28803. SMILES: C(CC(=O)NC(CCC(=O)C1N=N1)C(=O)NC(CCC(=O)C2N=N2)C(=O)O)C(C(=O)O)N.