Products

What will AGI do for Bazedoxifene?

This classification denotes a selective estrogen receptor modulator with the molecular formula C30H34N2O3, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier Q16TT9C5BK, chemically known as 1h-indol-5-ol, 1-((4-(2-(hexahydro-1h-azepin-1-yl)ethoxy)phenyl)methyl)-2-(4-hydroxyphenyl)-3-methyl- but generally known as bazedoxifene, which bears US NIH Compound Identifier 154257. Bazedoxifene most often comes in basic and acetate forms. European Medicines Agency schedules Bazedoxifene in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB26694. World Health Organization schedules bazedoxifene in its Anatomical Therapeutic Chemical (ATC) Classification. Most nations schedule bazedoxifene under HS 29339990 and SITC 51577. As of Q4 2014, BAZEDOXIFENE remains the US FDA Preferred Term for this commodity. Bazedoxifene bears US NLM identifiers UMLS ID C2346970 and NCI Concept Code C73598. SMILES: O(CCN1CCCCCC1)C1CCC(CN2C(C(C3C2CCC(O)C3)C)C2CCC(O)CC2)CC1.