Products

What will AGI do for Bendazol hydrochloride?

This classification denotes a vasodilating agent C14H12N2.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier ME751TL810, chemically known as 1h-benzimidazole, 2-(phenylmethyl)-, hydrochloride (1:1), but more generally known as bendazol hydrochloride, which bears US NIH Compound Identifier 164798. European Medicines Agency schedules Bendazol hydrochloride in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB32247. Most nations, for tariff and trade purposes, schedule bendazol hydrochloride under HS 29339990 and SITC 51577. As of Q4 2014, BENDAZOL HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. SMILES: C1CCC(CC1)CC2[NH]C3CCCCC3N2.CL.