Products

What will AGI do for Benproperine trihydrogen phosphate?

This classification denotes an antitussive agent with the molecular formula C21H27NO.H3O4P, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier S831Z48C5W, chemically known as 1-(2-(2-benzylphenoxy)-1-methylethyl)piperidine monophosphate, but more generally known as benproperine trihydrogen phosphate, which bears US NIH Compound Identifier 167811. European Medicines Agency schedules benproperine trihydrogen phosphate or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB05728MIG. Most nations, for tariff purposes, schedule benproperine trihydrogen phosphate under HS 29333999. SMILES: CC(COC1CCCCC1CC2CCCCC2)N3CCCCC3.OP(=O)(O)O.