Products

What will AGI do for Benzalkonium chloride?

This classification denotes a surface-active agent, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier F5UM2KM3W7. European Medicines Agency schedules Benzalkonium chloride in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB00714MIG. Benzalkonium chloride generally arises in the molecular formula C22H40CLN. The term BENZALKONIUM CHLORIDE is an International Non-Proprietary Name or INN. Most nations schedule benzalkonium chloride under HS 34021200 and SITC 55421. As of Q4 2014, BENZALKONIUM CHLORIDE remains the US FDA Preferred Term for this commodity. Benzalkonium chloride bears US NLM identifiers UMLS ID C0005026 and NCI Concept Code C82282. SMILES: C[NH+](C)CC1=CC=CC=C1.[Cl-].