Products

What will AGI do for Benzoyl peroxide?

This classification denotes an anti-infective agent with the molecular formula C14H10O4, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier W9WZN9A0GM, chemically known as peroxide, dibenzoyl but generally known as benzoyl peroxide, which bears US NIH Compound Identifier 7187. European Medicines Agency schedules Benzoyl peroxide in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB13020MIG. World Health Organization schedules benzoyl peroxide in its Anatomical Therapeutic Chemical (ATC) Classification. Most nations schedule benzoyl peroxide under HS 29163200 and SITC 51379. As of Q4 2014, BENZOYL PEROXIDE remains the US FDA Preferred Term for this commodity. Benzoyl peroxide bears US NLM identifiers UMLS ID C0005088 and NCI Concept Code C47411. SMILES: C1=CC=C(C=C1)C(=O)OOC(=O)C2=CC=CC=C2.