Products
What will AGI do for Benzpiperylon?
This classification denotes a nonsteroidal antiinflammatory drug with the molecular formula C22H25N3O, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 7NHY63BKIV, chemically known as 1,2-dihydro-2-(1-methyl-4-piperidinyl)-4-phenyl-5-(phenylmethyl)-3h-pyrazol-3-one but generally known as benzpiperylon, which bears US NIH Compound Identifier 24039. European Medicines Agency schedules Benzpiperylone in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB05765MIG. The term BENZPIPERYLONE is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 19 1975, List 5). As of Q4 2014, BENZPIPERYLON remains the US FDA Preferred Term for this commodity. Benzpiperylon bears US NLM identifiers UMLS ID C1957227 and NCI Concept Code C83547. SMILES: CN1CCC(CC1)N2C(=O)C(=C(N2)CC3=CC=CC=C3)C4=CC=CC=C4.