Products
What will AGI do for Benzydamine hydrochloride?
This classification denotes a nonsteroidal antiinflammatory drug with the molecular formula C19H23N3O.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier K2GI407R4Q, chemically known as 3-((1-benzyl-1h-indazol-3-yl)oxy)-n,n-dimethylpropylamine monohydrochloride but more generally known as benzydamine hydrochloride, which bears US NIH Compound Identifier 65464. European Medicines Agency schedules Benzydamine hydrochloride in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB00737MIG. Most nations, for tariff and trade purposes, schedule benzydamine hydrochloride under HS 29339990 and SITC 51577. As of Q4 2014, BENZYDAMINE HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Benzydamine hydrochloride bears US NLM identifiers UMLS ID C1511108 and NCI Concept Code C1581. SMILES: CN(C)CCCOC1C2CCCCC2N(N1)CC3CCCCC3.CL.