Products

What will AGI do for Benzylthiouracil?

This classification denotes a uridine phosphorylase antagonist and inhibitor with the molecular formula C11H10N2OS, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier PZ35LUM333, chemically known as uracil, benzylthio- but generally known as benzylthiouracil, which bears US NIH Compound Identifier 198125. European Medicines Agency schedules Benzylthiouracil in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB13040MIG. World Health Organization schedules benzylthiouracil in its Anatomical Therapeutic Chemical (ATC) Classification. As of Q4 2014, BENZYLTHIOURACIL remains the US FDA Preferred Term for this commodity. SMILES: C1C=CC=CC1CC23C(=NC=NC2=O)S3.