Products

What will AGI do for Bephenium?

This classification denotes an antinematodal agent with the molecular formula C17H22NO, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier PXO9B4983I, chemically known as n,n-dimethyl-n-(2-phenoxyethyl)-benzenemethanaminium but generally known as bephenium, which bears US NIH Compound Identifier 19667. Bephenium most often comes in chloride and hydroxynaphthoate forms. World Health Organization schedules bephenium in its Anatomical Therapeutic Chemical (ATC) Classification. As of Q4 2014, BEPHENIUM remains the US FDA Preferred Term for this commodity. SMILES: C[N+](C)(CCOC1=CC=CC=C1)CC2=CC=CC=C2.