Products

What will AGI do for Bervastatin?

This classification denotes a hmg-coa reductase inhibitor with the molecular formula C28H31FO5, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 057SF9C1UZ, chemically known as 6-heptenoic acid, 7-(4-(4-fluorophenyl)spiro(2h-1-benzopyran-2,1-cyclopentan)-3-yl)-3,5-dihydroxy-, ethyl ester, (3r,5s,6e)-rel- but generally known as bervastatin, which bears US NIH Compound Identifier 6436003. European Medicines Agency schedules Bervastatin in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB05785MIG. The term BERVASTATIN is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 9, No. 3, 1995, List 35). Most nations schedule bervastatin under HS 29329985 and SITC 51569. As of Q4 2014, BERVASTATIN remains the US FDA Preferred Term for this commodity. Bervastatin bears US NLM identifiers UMLS ID C2698372 and NCI Concept Code C77441. SMILES: Fc1ccc(C2=C(C3(Oc4c2cccc4)CCCC3)/C=C/C(O)CC(O)CC(=O)OCC)cc1.