Products
What will AGI do for Bethanechol?
This classification denotes an antimuscarinic agent with the molecular formula C7H17N2O2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 004F72P8F4, chemically known as 2-((aminocarbonyl)oxy)-n,n,n-trimethyl-1-propanaminium but generally known as bethanechol, which bears US NIH Compound Identifier 2370. European Medicines Agency schedules Bethanechol in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB13063MIG. World Health Organization schedules bethanechol in its Anatomical Therapeutic Chemical (ATC) Classification. As of Q4 2014, BETHANECHOL remains the US FDA Preferred Term for this commodity. Bethanechol bears US NLM identifiers UMLS ID C0053526 and NCI Concept Code C76039. SMILES: O(C(C[N](C)(C)C)C)C(=O)N.