Products

What will AGI do for Binedaline hydrochloride?

This classification denotes an antidepressant agent with the molecular formula C19H23N3.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier WEK9FVT37G, chemically known as n,n,n-trimethyl-n-(3-phenyl-1h-indol-1-yl)ethylenediamine monohydrochloride but more generally known as binedaline hydrochloride, which bears US NIH Compound Identifier 42509. European Medicines Agency schedules Binedaline hydrochloride in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB25841. Most nations, for tariff and trade purposes, schedule binedaline hydrochloride under HS 29339990. As of Q4 2014, BINEDALINE HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. SMILES: CN(C)CCN(C)N1CC(C2C1CCCC2)C3CCCCC3.CL.