Products

What will AGI do for Biperiden?

This classification denotes an antiparkinsonian agent and antimuscarinic agent with the molecular formula C21H29NO.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier K35N76CUHF, chemically known as 5-norbornene-2-methanol, alpha-phenyl-alpha-(2-piperidinoethyl)- but generally known as biperiden hydrochloride, which bears US NIH Compound Identifier 2381. European Medicines Agency schedules Biperiden hydrochloride in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB00807MIG. Most nations schedule biperiden under HS 29333999 and SITC 51574. As of Q4 2014, BIPERIDEN remains the US FDA Preferred Term for this commodity. Biperiden bears US NLM identifiers UMLS ID C0005578 and NCI Concept Code C65263. SMILES: OC(C1C2CC(C1)C=C2)(CCN1CCCCC1)C1CCCCC1.