Products

What will AGI do for Bismuth subcitrate?

This classification denotes a cytoprotective agent and anti-ulcer agent with the molecular formula 2C6H5O7.Bi.3K, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier HS813P8QPX, chemically known as 1,2,3-propanetricarboxylic acid, 2-hydroxy-, bismuth(3+) potassium salt (2:1:3) but generally known as bismuth subcitrate, which bears US NIH Compound Identifier 6335486. European Medicines Agency schedules Bismuth subcitrate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB13089MIG. World Health Organization schedules bismuth subcitrate in its Anatomical Therapeutic Chemical (ATC) Classification. As of Q4 2014, BISMUTH SUBCITRATE remains the US FDA Preferred Term for this commodity. Bismuth subcitrate bears US NLM identifiers UMLS ID C0106556 and NCI Concept Code C1351. SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.[Bi+3].